C20H22N2O3 — CID 9182397
(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-ethyl-N'-(4-methylphenyl)prop-2-enehydrazide (PubChem CID 9182397) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-ethyl-N'-(4-methylphenyl)prop-2-enehydrazide.
| Compound Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-ethyl-N'-(4-methylphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9182397 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-ethyl-N'-(4-methylphenyl)prop-2-enehydrazide |
| SMILES | CCN(NC(=O)/C=C/c1ccc2c(c1)OCCO2)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-3-22(17-8-4-15(2)5-9-17)21-20(23)11-7-16-6-10-18-19(14-16)25-13-12-24-18/h4-11,14H,3,12-13H2,1-2H3,(H,21,23)/b11-7+ |
| InChIKey | LAIBRJDYIHDHPQ-YRNVUSSQSA-N |
| XLogP | 3.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|