C17H20N2OS — CID 9182749
(E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide (PubChem CID 9182749) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide.
| Compound Name | (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9182749 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide |
| SMILES | CCN(NC(=O)/C=C/c1ccc(C)s1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H20N2OS/c1-4-19(15-8-5-13(2)6-9-15)18-17(20)12-11-16-10-7-14(3)21-16/h5-12H,4H2,1-3H3,(H,18,20)/b12-11+ |
| InChIKey | PFQXQUHPYCHLRP-VAWYXSNFSA-N |
| XLogP | 3.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|