About (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide
(E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide (PubChem CID 9182749) has the molecular formula C17H20N2OS
and a molecular weight of 300.43 g/mol. Its IUPAC name is (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide.
Molecular Properties
| Compound Name | (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide |
| PubChem CID | 9182749 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide |
| SMILES | CCN(NC(=O)/C=C/c1ccc(C)s1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H20N2OS/c1-4-19(15-8-5-13(2)6-9-15)18-17(20)12-11-16-10-7-14(3)21-16/h5-12H,4H2,1-3H3,(H,18,20)/b12-11+ |
| InChIKey | PFQXQUHPYCHLRP-VAWYXSNFSA-N |
| XLogP | 3.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide?
The IUPAC name of (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide (CID 9182749) is (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide.
What is the SMILES notation for (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide?
The canonical SMILES for (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide is CCN(NC(=O)/C=C/c1ccc(C)s1)c1ccc(C)cc1.
What is the InChIKey of (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide?
The InChIKey is PFQXQUHPYCHLRP-VAWYXSNFSA-N. The full InChI is InChI=1S/C17H20N2OS/c1-4-19(15-8-5-13(2)6-9-15)18-17(20)12-11-16-10-7-14(3)21-16/h5-12H,4H2,1-3H3,(H,18,20)/b12-11+.
What are the key properties of (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide?
(E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide has a molecular weight of 300.43 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-ethyl-N'-(4-methylphenyl)-3-(5-methylthiophen-2-yl)prop-2-enehydrazide is sourced from PubChem (CID 9182749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).