C19H17F2NO3 — CID 110712183
N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]-3,4-difluorobenzamide (PubChem CID 110712183) has the molecular formula C19H17F2NO3 and a molecular weight of 345.35 g/mol. Its IUPAC name is N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]-3,4-difluorobenzamide.
| Compound Name | N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 110712183 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[(E)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-enyl]-3,4-difluorobenzamide |
| SMILES | O=C(NCC/C=C/c1ccc2c(c1)OCCO2)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17F2NO3/c20-15-6-5-14(12-16(15)21)19(23)22-8-2-1-3-13-4-7-17-18(11-13)25-10-9-24-17/h1,3-7,11-12H,2,8-10H2,(H,22,23)/b3-1+ |
| InChIKey | WYPAORLVWWSAJU-HNQUOIGGSA-N |
| XLogP | 3.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|