C12H13F2NO3 — CID 110369952
N-[2-(1,3-dioxolan-2-yl)ethyl]-3,4-difluorobenzamide (PubChem CID 110369952) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is N-[2-(1,3-dioxolan-2-yl)ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(1,3-dioxolan-2-yl)ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 110369952 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[2-(1,3-dioxolan-2-yl)ethyl]-3,4-difluorobenzamide |
| SMILES | O=C(NCCC1OCCO1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H13F2NO3/c13-9-2-1-8(7-10(9)14)12(16)15-4-3-11-17-5-6-18-11/h1-2,7,11H,3-6H2,(H,15,16) |
| InChIKey | AJKBLNCMEWVPIB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |