C19H18F2N2O4 — CID 113055124
N-[2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]ethyl]-3,4-difluorobenzamide (PubChem CID 113055124) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is N-[2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113055124 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]ethyl]-3,4-difluorobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(F)c(F)c1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18F2N2O4/c1-12(24)23(10-13-2-5-17-18(8-13)27-11-26-17)7-6-22-19(25)14-3-4-15(20)16(21)9-14/h2-5,8-9H,6-7,10-11H2,1H3,(H,22,25) |
| InChIKey | BAVGZFSJCZYWQU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |