C20H22N2O5 — CID 113055103
N-[2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]ethyl]-2-methoxybenzamide (PubChem CID 113055103) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]ethyl]-2-methoxybenzamide.
| Compound Name | N-[2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 113055103 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[2-[acetyl(1,3-benzodioxol-5-ylmethyl)amino]ethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCCN(Cc1ccc2c(c1)OCO2)C(C)=O |
| InChI | InChI=1S/C20H22N2O5/c1-14(23)22(12-15-7-8-18-19(11-15)27-13-26-18)10-9-21-20(24)16-5-3-4-6-17(16)25-2/h3-8,11H,9-10,12-13H2,1-2H3,(H,21,24) |
| InChIKey | ZQCQRDQSKAQYNZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |