C24H26N2O7 — CID 101454504
6-[(E)-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethenyl]-2,3-dihydrophthalazine-1,4-dione (PubChem CID 101454504) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is 6-[(E)-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethenyl]-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 6-[(E)-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethenyl]-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 101454504 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 6-[(E)-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)ethenyl]-2,3-dihydrophthalazine-1,4-dione |
| SMILES | O=c1[nH][nH]c(=O)c2cc(/C=C/c3ccc4c(c3)OCCOCCOCCOCCO4)ccc12 |
| InChI | InChI=1S/C24H26N2O7/c27-23-19-5-3-17(15-20(19)24(28)26-25-23)1-2-18-4-6-21-22(16-18)33-14-12-31-10-8-29-7-9-30-11-13-32-21/h1-6,15-16H,7-14H2,(H,25,27)(H,26,28)/b2-1+ |
| InChIKey | WNAJXYQPFBBJFJ-OWOJBTEDSA-N |
| XLogP | 2.21 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|