About 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene
1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene (PubChem CID 174264665) has the molecular formula C12H19NO5
and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene.
Molecular Properties
| Compound Name | 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene |
| PubChem CID | 174264665 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene |
| SMILES | COCCOCCOC.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C6H14O3/c8-7(9)6-4-2-1-3-5-6;1-7-3-5-9-6-4-8-2/h1-5H;3-6H2,1-2H3 |
| InChIKey | QZRJWAYGEOANFT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene?
The IUPAC name of 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene (CID 174264665) is 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene.
What is the SMILES notation for 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene?
The canonical SMILES for 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene is COCCOCCOC.O=[N+]([O-])c1ccccc1.
What is the InChIKey of 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene?
The InChIKey is QZRJWAYGEOANFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C6H14O3/c8-7(9)6-4-2-1-3-5-6;1-7-3-5-9-6-4-8-2/h1-5H;3-6H2,1-2H3.
What are the key properties of 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene?
1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene has a molecular weight of 257.29 g/mol, XLogP of 1.89, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-(2-methoxyethoxy)ethane;nitrobenzene is sourced from PubChem (CID 174264665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).