C28H25N3O5 — CID 101263202
6-[3-(6-nitro-1,3-benzoxazol-2-yl)carbazol-9-yl]hexyl prop-2-enoate (PubChem CID 101263202) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is 6-[3-(6-nitro-1,3-benzoxazol-2-yl)carbazol-9-yl]hexyl prop-2-enoate.
| Compound Name | 6-[3-(6-nitro-1,3-benzoxazol-2-yl)carbazol-9-yl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 101263202 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 6-[3-(6-nitro-1,3-benzoxazol-2-yl)carbazol-9-yl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCn1c2ccccc2c2cc(-c3nc4ccc([N+](=O)[O-])cc4o3)ccc21 |
| InChI | InChI=1S/C28H25N3O5/c1-2-27(32)35-16-8-4-3-7-15-30-24-10-6-5-9-21(24)22-17-19(11-14-25(22)30)28-29-23-13-12-20(31(33)34)18-26(23)36-28/h2,5-6,9-14,17-18H,1,3-4,7-8,15-16H2 |
| InChIKey | GQCLCIUAIMNXAY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 100.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|