C48H56N2O6 — CID 146213694
(1-methylcyclohexyl) 4-[3-[9-[4-(1-methylcyclohexyl)oxycarbonyloxybutyl]carbazol-3-yl]carbazol-9-yl]butyl carbonate (PubChem CID 146213694) has the molecular formula C48H56N2O6 and a molecular weight of 756.98 g/mol. Its IUPAC name is (1-methylcyclohexyl) 4-[3-[9-[4-(1-methylcyclohexyl)oxycarbonyloxybutyl]carbazol-3-yl]carbazol-9-yl]butyl carbonate.
| Compound Name | (1-methylcyclohexyl) 4-[3-[9-[4-(1-methylcyclohexyl)oxycarbonyloxybutyl]carbazol-3-yl]carbazol-9-yl]butyl carbonate |
|---|---|
| PubChem CID | 146213694 |
| Molecular Formula | C48H56N2O6 |
| Molecular Weight | 756.98 g/mol |
| Exact Mass | 756.41 |
| IUPAC Name | (1-methylcyclohexyl) 4-[3-[9-[4-(1-methylcyclohexyl)oxycarbonyloxybutyl]carbazol-3-yl]carbazol-9-yl]butyl carbonate |
| SMILES | CC1(OC(=O)OCCCCn2c3ccccc3c3cc(-c4ccc5c(c4)c4ccccc4n5CCCCOC(=O)OC4(C)CCCCC4)ccc32)CCCCC1 |
| InChI | InChI=1S/C48H56N2O6/c1-47(25-9-3-10-26-47)55-45(51)53-31-15-13-29-49-41-19-7-5-17-37(41)39-33-35(21-23-43(39)49)36-22-24-44-40(34-36)38-18-6-8-20-42(38)50(44)30-14-16-32-54-46(52)56-48(2)27-11-4-12-28-48/h5-8,17-24,33-34H,3-4,9-16,25-32H2,1-2H3 |
| InChIKey | MJUMBEMUFZHWLO-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.98 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|