C66H76N2O8 — CID 146213668
(1-butylcyclopentyl) 4-[[4-[2-[9-[4-[4-(1-butylcyclopentyl)oxycarbonyloxybutoxymethyl]phenyl]carbazol-3-yl]carbazol-9-yl]phenyl]methoxy]butyl carbonate (PubChem CID 146213668) has the molecular formula C66H76N2O8 and a molecular weight of 1025.34 g/mol. Its IUPAC name is (1-butylcyclopentyl) 4-[[4-[2-[9-[4-[4-(1-butylcyclopentyl)oxycarbonyloxybutoxymethyl]phenyl]carbazol-3-yl]carbazol-9-yl]phenyl]methoxy]butyl carbonate.
| Compound Name | (1-butylcyclopentyl) 4-[[4-[2-[9-[4-[4-(1-butylcyclopentyl)oxycarbonyloxybutoxymethyl]phenyl]carbazol-3-yl]carbazol-9-yl]phenyl]methoxy]butyl carbonate |
|---|---|
| PubChem CID | 146213668 |
| Molecular Formula | C66H76N2O8 |
| Molecular Weight | 1025.34 g/mol |
| Exact Mass | 1024.56 |
| IUPAC Name | (1-butylcyclopentyl) 4-[[4-[2-[9-[4-[4-(1-butylcyclopentyl)oxycarbonyloxybutoxymethyl]phenyl]carbazol-3-yl]carbazol-9-yl]phenyl]methoxy]butyl carbonate |
| SMILES | CCCCC1(OC(=O)OCCCCOCc2ccc(-n3c4ccccc4c4cc(-c5ccc6c7ccccc7n(-c7ccc(COCCCCOC(=O)OC8(CCCC)CCCC8)cc7)c6c5)ccc43)cc2)CCCC1 |
| InChI | InChI=1S/C66H76N2O8/c1-3-5-35-65(37-11-12-38-65)75-63(69)73-43-17-15-41-71-47-49-23-29-53(30-24-49)67-60-22-10-8-20-56(60)58-45-51(28-34-61(58)67)52-27-33-57-55-19-7-9-21-59(55)68(62(57)46-52)54-31-25-50(26-32-54)48-72-42-16-18-44-74-64(70)76-66(36-6-4-2)39-13-14-40-66/h7-10,19-34,45-46H,3-6,11-18,35-44,47-48H2,1-2H3 |
| InChIKey | YNAIQUFPFOMZRL-UHFFFAOYSA-N |
| XLogP | 17.45 |
| TPSA | 99.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.34 |
| LogP ≤ 5 | 17.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|