C46H42N2O3 — CID 147029302
2-[[9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazol-3-yl]methoxy]ethyl 2,2-dimethylpentanoate (PubChem CID 147029302) has the molecular formula C46H42N2O3 and a molecular weight of 670.85 g/mol. Its IUPAC name is 2-[[9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazol-3-yl]methoxy]ethyl 2,2-dimethylpentanoate.
| Compound Name | 2-[[9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazol-3-yl]methoxy]ethyl 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 147029302 |
| Molecular Formula | C46H42N2O3 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | 2-[[9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazol-3-yl]methoxy]ethyl 2,2-dimethylpentanoate |
| SMILES | CCCC(C)(C)C(=O)OCCOCc1ccc2c(c1)c1ccccc1n2-c1ccc(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C46H42N2O3/c1-4-27-46(2,3)45(49)51-29-28-50-31-32-17-26-44-40(30-32)39-13-7-10-16-43(39)48(44)36-24-20-34(21-25-36)33-18-22-35(23-19-33)47-41-14-8-5-11-37(41)38-12-6-9-15-42(38)47/h5-26,30H,4,27-29,31H2,1-3H3 |
| InChIKey | AXGYRMVSWVEQOR-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 45.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|