C44H38N2O2 — CID 163588358
2-methylpentan-2-yl 2-[9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazol-3-yl]acetate (PubChem CID 163588358) has the molecular formula C44H38N2O2 and a molecular weight of 626.80 g/mol. Its IUPAC name is 2-methylpentan-2-yl 2-[9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazol-3-yl]acetate.
| Compound Name | 2-methylpentan-2-yl 2-[9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazol-3-yl]acetate |
|---|---|
| PubChem CID | 163588358 |
| Molecular Formula | C44H38N2O2 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 2-methylpentan-2-yl 2-[9-[4-(4-carbazol-9-ylphenyl)phenyl]carbazol-3-yl]acetate |
| SMILES | CCCC(C)(C)OC(=O)Cc1ccc2c(c1)c1ccccc1n2-c1ccc(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C44H38N2O2/c1-4-27-44(2,3)48-43(47)29-30-17-26-42-38(28-30)37-13-7-10-16-41(37)46(42)34-24-20-32(21-25-34)31-18-22-33(23-19-31)45-39-14-8-5-11-35(39)36-12-6-9-15-40(36)45/h5-26,28H,4,27,29H2,1-3H3 |
| InChIKey | GNKBUHVARULKGV-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |