C56H42N2O4 — CID 88569869
methyl 2-[4-[3-(N-(4-carbazol-9-ylphenyl)anilino)-10-[4-(2-methoxy-2-oxoethyl)phenyl]anthracen-9-yl]phenyl]acetate (PubChem CID 88569869) has the molecular formula C56H42N2O4 and a molecular weight of 806.96 g/mol. Its IUPAC name is methyl 2-[4-[3-(N-(4-carbazol-9-ylphenyl)anilino)-10-[4-(2-methoxy-2-oxoethyl)phenyl]anthracen-9-yl]phenyl]acetate.
| Compound Name | methyl 2-[4-[3-(N-(4-carbazol-9-ylphenyl)anilino)-10-[4-(2-methoxy-2-oxoethyl)phenyl]anthracen-9-yl]phenyl]acetate |
|---|---|
| PubChem CID | 88569869 |
| Molecular Formula | C56H42N2O4 |
| Molecular Weight | 806.96 g/mol |
| Exact Mass | 806.31 |
| IUPAC Name | methyl 2-[4-[3-(N-(4-carbazol-9-ylphenyl)anilino)-10-[4-(2-methoxy-2-oxoethyl)phenyl]anthracen-9-yl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(-c2c3ccccc3c(-c3ccc(CC(=O)OC)cc3)c3cc(N(c4ccccc4)c4ccc(-n5c6ccccc6c6ccccc65)cc4)ccc23)cc1 |
| InChI | InChI=1S/C56H42N2O4/c1-61-53(59)34-37-20-24-39(25-21-37)55-47-16-6-7-17-48(47)56(40-26-22-38(23-27-40)35-54(60)62-2)50-36-44(32-33-49(50)55)57(41-12-4-3-5-13-41)42-28-30-43(31-29-42)58-51-18-10-8-14-45(51)46-15-9-11-19-52(46)58/h3-33,36H,34-35H2,1-2H3 |
| InChIKey | ICZPIQGYNLHKLZ-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.96 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|