C54H38N2O4 — CID 59211124
methyl 3-[3-(N-(4-carbazol-9-ylphenyl)anilino)-10-(3-methoxycarbonylphenyl)anthracen-9-yl]benzoate (PubChem CID 59211124) has the molecular formula C54H38N2O4 and a molecular weight of 778.91 g/mol. Its IUPAC name is methyl 3-[3-(N-(4-carbazol-9-ylphenyl)anilino)-10-(3-methoxycarbonylphenyl)anthracen-9-yl]benzoate.
| Compound Name | methyl 3-[3-(N-(4-carbazol-9-ylphenyl)anilino)-10-(3-methoxycarbonylphenyl)anthracen-9-yl]benzoate |
|---|---|
| PubChem CID | 59211124 |
| Molecular Formula | C54H38N2O4 |
| Molecular Weight | 778.91 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | methyl 3-[3-(N-(4-carbazol-9-ylphenyl)anilino)-10-(3-methoxycarbonylphenyl)anthracen-9-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2c3ccccc3c(-c3cccc(C(=O)OC)c3)c3cc(N(c4ccccc4)c4ccc(-n5c6ccccc6c6ccccc65)cc4)ccc23)c1 |
| InChI | InChI=1S/C54H38N2O4/c1-59-53(57)37-16-12-14-35(32-37)51-45-22-6-7-23-46(45)52(36-15-13-17-38(33-36)54(58)60-2)48-34-42(30-31-47(48)51)55(39-18-4-3-5-19-39)40-26-28-41(29-27-40)56-49-24-10-8-20-43(49)44-21-9-11-25-50(44)56/h3-34H,1-2H3 |
| InChIKey | JRWXZTZUXHARKX-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.91 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|