C29H26N2O8 — CID 100934850
[4-(6-nitro-1,3-benzoxazol-2-yl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 100934850) has the molecular formula C29H26N2O8 and a molecular weight of 530.53 g/mol. Its IUPAC name is [4-(6-nitro-1,3-benzoxazol-2-yl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-(6-nitro-1,3-benzoxazol-2-yl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 100934850 |
| Molecular Formula | C29H26N2O8 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | [4-(6-nitro-1,3-benzoxazol-2-yl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(-c3nc4ccc([N+](=O)[O-])cc4o3)cc2)cc1 |
| InChI | InChI=1S/C29H26N2O8/c1-2-27(32)37-18-6-4-3-5-17-36-23-12-9-21(10-13-23)29(33)38-24-14-7-20(8-15-24)28-30-25-16-11-22(31(34)35)19-26(25)39-28/h2,7-16,19H,1,3-6,17-18H2 |
| InChIKey | VHFZSGVIYGQFIX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 131.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|