C36H32N2O6 — CID 129170752
2-[2-methyl-3-[1-[2-methyl-1-(2-prop-2-enoyloxyethyl)indol-3-yl]-3-oxo-2-benzofuran-1-yl]indol-1-yl]ethyl prop-2-enoate (PubChem CID 129170752) has the molecular formula C36H32N2O6 and a molecular weight of 588.66 g/mol. Its IUPAC name is 2-[2-methyl-3-[1-[2-methyl-1-(2-prop-2-enoyloxyethyl)indol-3-yl]-3-oxo-2-benzofuran-1-yl]indol-1-yl]ethyl prop-2-enoate.
| Compound Name | 2-[2-methyl-3-[1-[2-methyl-1-(2-prop-2-enoyloxyethyl)indol-3-yl]-3-oxo-2-benzofuran-1-yl]indol-1-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 129170752 |
| Molecular Formula | C36H32N2O6 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 2-[2-methyl-3-[1-[2-methyl-1-(2-prop-2-enoyloxyethyl)indol-3-yl]-3-oxo-2-benzofuran-1-yl]indol-1-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCn1c(C)c(C2(c3c(C)n(CCOC(=O)C=C)c4ccccc34)OC(=O)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C36H32N2O6/c1-5-31(39)42-21-19-37-23(3)33(26-14-8-11-17-29(26)37)36(28-16-10-7-13-25(28)35(41)44-36)34-24(4)38(20-22-43-32(40)6-2)30-18-12-9-15-27(30)34/h5-18H,1-2,19-22H2,3-4H3 |
| InChIKey | BWXWJRZWVDORHF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|