C31H32N2O2 — CID 139802352
3-(1-ethyl-2-methylindol-3-yl)-3-(2-ethyl-4-pyrrolidin-1-ylphenyl)-2-benzofuran-1-one (PubChem CID 139802352) has the molecular formula C31H32N2O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-(1-ethyl-2-methylindol-3-yl)-3-(2-ethyl-4-pyrrolidin-1-ylphenyl)-2-benzofuran-1-one.
| Compound Name | 3-(1-ethyl-2-methylindol-3-yl)-3-(2-ethyl-4-pyrrolidin-1-ylphenyl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139802352 |
| Molecular Formula | C31H32N2O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 3-(1-ethyl-2-methylindol-3-yl)-3-(2-ethyl-4-pyrrolidin-1-ylphenyl)-2-benzofuran-1-one |
| SMILES | CCc1cc(N2CCCC2)ccc1C1(c2c(C)n(CC)c3ccccc23)OC(=O)c2ccccc21 |
| InChI | InChI=1S/C31H32N2O2/c1-4-22-20-23(32-18-10-11-19-32)16-17-26(22)31(27-14-8-6-12-24(27)30(34)35-31)29-21(3)33(5-2)28-15-9-7-13-25(28)29/h6-9,12-17,20H,4-5,10-11,18-19H2,1-3H3 |
| InChIKey | SSJWSBPSLZXGNM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |