C26H19N3O3 — CID 155807298
13-hydroxy-3,23-bis(prop-2-enyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 155807298) has the molecular formula C26H19N3O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 13-hydroxy-3,23-bis(prop-2-enyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 13-hydroxy-3,23-bis(prop-2-enyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 155807298 |
| Molecular Formula | C26H19N3O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 13-hydroxy-3,23-bis(prop-2-enyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | C=CCn1c2ccccc2c2c3c(c4c5ccccc5n(CC=C)c4c21)C(=O)N(O)C3=O |
| InChI | InChI=1S/C26H19N3O3/c1-3-13-27-17-11-7-5-9-15(17)19-21-22(26(31)29(32)25(21)30)20-16-10-6-8-12-18(16)28(14-4-2)24(20)23(19)27/h3-12,32H,1-2,13-14H2 |
| InChIKey | OWCBXAYVALOUSY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|