C32H28N2O2 — CID 177480673
3-(4-hydroxy-2-methyl-9-prop-2-enylcarbazol-3-yl)-2-methyl-9-prop-2-enylcarbazol-4-ol (PubChem CID 177480673) has the molecular formula C32H28N2O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-(4-hydroxy-2-methyl-9-prop-2-enylcarbazol-3-yl)-2-methyl-9-prop-2-enylcarbazol-4-ol.
| Compound Name | 3-(4-hydroxy-2-methyl-9-prop-2-enylcarbazol-3-yl)-2-methyl-9-prop-2-enylcarbazol-4-ol |
|---|---|
| PubChem CID | 177480673 |
| Molecular Formula | C32H28N2O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 3-(4-hydroxy-2-methyl-9-prop-2-enylcarbazol-3-yl)-2-methyl-9-prop-2-enylcarbazol-4-ol |
| SMILES | C=CCn1c2ccccc2c2c(O)c(-c3c(C)cc4c(c3O)c3ccccc3n4CC=C)c(C)cc21 |
| InChI | InChI=1S/C32H28N2O2/c1-5-15-33-23-13-9-7-11-21(23)29-25(33)17-19(3)27(31(29)35)28-20(4)18-26-30(32(28)36)22-12-8-10-14-24(22)34(26)16-6-2/h5-14,17-18,35-36H,1-2,15-16H2,3-4H3 |
| InChIKey | LMGJKWYRWGXIDC-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|