C14H15N — CID 126631875
(2E)-1-ethyl-3-methylidene-2-prop-2-enylideneindole (PubChem CID 126631875) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is (2E)-1-ethyl-3-methylidene-2-prop-2-enylideneindole.
| Compound Name | (2E)-1-ethyl-3-methylidene-2-prop-2-enylideneindole |
|---|---|
| PubChem CID | 126631875 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (2E)-1-ethyl-3-methylidene-2-prop-2-enylideneindole |
| SMILES | C=C/C=c1\c(=C)c2ccccc2n1CC |
| InChI | InChI=1S/C14H15N/c1-4-8-13-11(3)12-9-6-7-10-14(12)15(13)5-2/h4,6-10H,1,3,5H2,2H3/b13-8+ |
| InChIKey | RTNNMJVEUXBQDW-MDWZMJQESA-N |
| XLogP | 2.04 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |