C37H35N5 — CID 143370230
(3E)-3-(1-carbazol-9-ylethylidene)-1-ethyl-2-[1-[(2E)-3-methylidene-2-prop-2-enylideneindol-1-yl]ethyl]-1-phenylguanidine (PubChem CID 143370230) has the molecular formula C37H35N5 and a molecular weight of 549.72 g/mol. Its IUPAC name is (3E)-3-(1-carbazol-9-ylethylidene)-1-ethyl-2-[1-[(2E)-3-methylidene-2-prop-2-enylideneindol-1-yl]ethyl]-1-phenylguanidine.
| Compound Name | (3E)-3-(1-carbazol-9-ylethylidene)-1-ethyl-2-[1-[(2E)-3-methylidene-2-prop-2-enylideneindol-1-yl]ethyl]-1-phenylguanidine |
|---|---|
| PubChem CID | 143370230 |
| Molecular Formula | C37H35N5 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | (3E)-3-(1-carbazol-9-ylethylidene)-1-ethyl-2-[1-[(2E)-3-methylidene-2-prop-2-enylideneindol-1-yl]ethyl]-1-phenylguanidine |
| SMILES | C=C/C=c1\c(=C)c2ccccc2n1C(C)/N=C(\N=C(/C)n1c2ccccc2c2ccccc21)N(CC)c1ccccc1 |
| InChI | InChI=1S/C37H35N5/c1-6-17-33-26(3)30-20-11-14-23-34(30)41(33)27(4)38-37(40(7-2)29-18-9-8-10-19-29)39-28(5)42-35-24-15-12-21-31(35)32-22-13-16-25-36(32)42/h6,8-25,27H,1,3,7H2,2,4-5H3/b33-17+,38-37+,39-28+ |
| InChIKey | BFYPUODYEKQKCP-HSGGAWICSA-N |
| XLogP | 7.49 |
| TPSA | 37.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|