C26H23N — CID 155027298
(2E)-3-methylidene-2-[(E)-3-(3-methylphenyl)but-2-enylidene]-1-phenylindole (PubChem CID 155027298) has the molecular formula C26H23N and a molecular weight of 349.48 g/mol. Its IUPAC name is (2E)-3-methylidene-2-[(E)-3-(3-methylphenyl)but-2-enylidene]-1-phenylindole.
| Compound Name | (2E)-3-methylidene-2-[(E)-3-(3-methylphenyl)but-2-enylidene]-1-phenylindole |
|---|---|
| PubChem CID | 155027298 |
| Molecular Formula | C26H23N |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (2E)-3-methylidene-2-[(E)-3-(3-methylphenyl)but-2-enylidene]-1-phenylindole |
| SMILES | C=c1/c(=C\C=C(/C)c2cccc(C)c2)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C26H23N/c1-19-10-9-11-22(18-19)20(2)16-17-25-21(3)24-14-7-8-15-26(24)27(25)23-12-5-4-6-13-23/h4-18H,3H2,1-2H3/b20-16+,25-17+ |
| InChIKey | SRLNKNMMFJFVIX-QJQTWEGFSA-N |
| XLogP | 5.23 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |