C20H21N — CID 146532616
2-methyl-1-(3-methylphenyl)-3-(2-methylprop-1-enyl)indole (PubChem CID 146532616) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-methyl-1-(3-methylphenyl)-3-(2-methylprop-1-enyl)indole.
| Compound Name | 2-methyl-1-(3-methylphenyl)-3-(2-methylprop-1-enyl)indole |
|---|---|
| PubChem CID | 146532616 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-methyl-1-(3-methylphenyl)-3-(2-methylprop-1-enyl)indole |
| SMILES | CC(C)=Cc1c(C)n(-c2cccc(C)c2)c2ccccc12 |
| InChI | InChI=1S/C20H21N/c1-14(2)12-19-16(4)21(17-9-7-8-15(3)13-17)20-11-6-5-10-18(19)20/h5-13H,1-4H3 |
| InChIKey | QXESRDKJSCYUQL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |