C18H18N2 — CID 144914531
N-[(1E)-buta-1,3-dienyl]-9-ethylcarbazol-3-amine (PubChem CID 144914531) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-9-ethylcarbazol-3-amine.
| Compound Name | N-[(1E)-buta-1,3-dienyl]-9-ethylcarbazol-3-amine |
|---|---|
| PubChem CID | 144914531 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-9-ethylcarbazol-3-amine |
| SMILES | C=C/C=C/Nc1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C18H18N2/c1-3-5-12-19-14-10-11-18-16(13-14)15-8-6-7-9-17(15)20(18)4-2/h3,5-13,19H,1,4H2,2H3/b12-5+ |
| InChIKey | JFEZPDUXTBTXHD-LFYBBSHMSA-N |
| XLogP | 4.93 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|