C13H13BO3 — CID 144640440
[2-ethenyl-3-[(Z)-prop-1-enyl]-1-benzofuran-7-yl]boronic acid (PubChem CID 144640440) has the molecular formula C13H13BO3 and a molecular weight of 228.06 g/mol. Its IUPAC name is [2-ethenyl-3-[(Z)-prop-1-enyl]-1-benzofuran-7-yl]boronic acid.
| Compound Name | [2-ethenyl-3-[(Z)-prop-1-enyl]-1-benzofuran-7-yl]boronic acid |
|---|---|
| PubChem CID | 144640440 |
| Molecular Formula | C13H13BO3 |
| Molecular Weight | 228.06 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [2-ethenyl-3-[(Z)-prop-1-enyl]-1-benzofuran-7-yl]boronic acid |
| SMILES | C=Cc1oc2c(B(O)O)cccc2c1/C=C\C |
| InChI | InChI=1S/C13H13BO3/c1-3-6-9-10-7-5-8-11(14(15)16)13(10)17-12(9)4-2/h3-8,15-16H,2H2,1H3/b6-3- |
| InChIKey | YVGSLNUZEUIDJF-UTCJRWHESA-N |
| XLogP | 1.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.06 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|