C19H17NO — CID 166654735
2-[2-ethenyl-3-[(Z)-prop-1-enyl]-1-benzofuran-5-yl]-6-methylpyridine (PubChem CID 166654735) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-[2-ethenyl-3-[(Z)-prop-1-enyl]-1-benzofuran-5-yl]-6-methylpyridine.
| Compound Name | 2-[2-ethenyl-3-[(Z)-prop-1-enyl]-1-benzofuran-5-yl]-6-methylpyridine |
|---|---|
| PubChem CID | 166654735 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[2-ethenyl-3-[(Z)-prop-1-enyl]-1-benzofuran-5-yl]-6-methylpyridine |
| SMILES | C=Cc1oc2ccc(-c3cccc(C)n3)cc2c1/C=C\C |
| InChI | InChI=1S/C19H17NO/c1-4-7-15-16-12-14(17-9-6-8-13(3)20-17)10-11-19(16)21-18(15)5-2/h4-12H,2H2,1,3H3/b7-4- |
| InChIKey | DUBKEJGYZYIFNY-DAXSKMNVSA-N |
| XLogP | 5.48 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |