C19H15NO — CID 145021144
3-ethenyl-2-[(Z)-prop-1-enyl]-6H-furo[3,2-c]carbazole (PubChem CID 145021144) has the molecular formula C19H15NO and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-ethenyl-2-[(Z)-prop-1-enyl]-6H-furo[3,2-c]carbazole.
| Compound Name | 3-ethenyl-2-[(Z)-prop-1-enyl]-6H-furo[3,2-c]carbazole |
|---|---|
| PubChem CID | 145021144 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-ethenyl-2-[(Z)-prop-1-enyl]-6H-furo[3,2-c]carbazole |
| SMILES | C=Cc1c(/C=C\C)oc2c1ccc1[nH]c3ccccc3c12 |
| InChI | InChI=1S/C19H15NO/c1-3-7-17-12(4-2)13-10-11-16-18(19(13)21-17)14-8-5-6-9-15(14)20-16/h3-11,20H,2H2,1H3/b7-3- |
| InChIKey | MJMHVMFSNZDVBD-CLTKARDFSA-N |
| XLogP | 5.74 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |