C35H25NO — CID 142570079
5-ethenyl-1-(6-phenyldibenzofuran-4-yl)-6-[(Z)-prop-1-enyl]-9H-carbazole (PubChem CID 142570079) has the molecular formula C35H25NO and a molecular weight of 475.59 g/mol. Its IUPAC name is 5-ethenyl-1-(6-phenyldibenzofuran-4-yl)-6-[(Z)-prop-1-enyl]-9H-carbazole.
| Compound Name | 5-ethenyl-1-(6-phenyldibenzofuran-4-yl)-6-[(Z)-prop-1-enyl]-9H-carbazole |
|---|---|
| PubChem CID | 142570079 |
| Molecular Formula | C35H25NO |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 5-ethenyl-1-(6-phenyldibenzofuran-4-yl)-6-[(Z)-prop-1-enyl]-9H-carbazole |
| SMILES | C=Cc1c(/C=C\C)ccc2[nH]c3c(-c4cccc5c4oc4c(-c6ccccc6)cccc45)cccc3c12 |
| InChI | InChI=1S/C35H25NO/c1-3-11-22-20-21-31-32(24(22)4-2)30-19-9-15-26(33(30)36-31)27-16-10-18-29-28-17-8-14-25(34(28)37-35(27)29)23-12-6-5-7-13-23/h3-21,36H,2H2,1H3/b11-3- |
| InChIKey | KFJNKGZGJIKZJY-JYOAFUTRSA-N |
| XLogP | 10.23 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |