C31H28 — CID 143613386
1,1'-biphenyl;12-ethenyl-5-[(E)-prop-1-enyl]benzo[10]annulene (PubChem CID 143613386) has the molecular formula C31H28 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1,1'-biphenyl;12-ethenyl-5-[(E)-prop-1-enyl]benzo[10]annulene.
| Compound Name | 1,1'-biphenyl;12-ethenyl-5-[(E)-prop-1-enyl]benzo[10]annulene |
|---|---|
| PubChem CID | 143613386 |
| Molecular Formula | C31H28 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1,1'-biphenyl;12-ethenyl-5-[(E)-prop-1-enyl]benzo[10]annulene |
| SMILES | C=Cc1ccccccc(/C=C/C)c2ccccc12.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18.C12H10/c1-3-11-17-13-8-6-5-7-12-16(4-2)18-14-9-10-15-19(17)18;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-15H,2H2,1H3;1-10H/b6-5-,7-5-,8-6-,11-3+,12-7+,13-8+,16-12+,17-13+,18-16-,19-17-; |
| InChIKey | WQLTYNSOWOOYQK-ZQOIJHNXSA-N |
| XLogP | 8.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |