About 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine
1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine (PubChem CID 156725547) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine |
| PubChem CID | 156725547 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine |
| SMILES | C=Cc1ccccc1/C=C\C.CCCNCC |
| InChI | InChI=1S/C11H12.C5H13N/c1-3-7-11-9-6-5-8-10(11)4-2;1-3-5-6-4-2/h3-9H,2H2,1H3;6H,3-5H2,1-2H3/b7-3-; |
| InChIKey | CFRSPDSXRLOASS-WYLUAFJRSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine?
The IUPAC name of 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine (CID 156725547) is 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine.
What is the SMILES notation for 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine?
The canonical SMILES for 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine is C=Cc1ccccc1/C=C\C.CCCNCC.
What is the InChIKey of 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine?
The InChIKey is CFRSPDSXRLOASS-WYLUAFJRSA-N. The full InChI is InChI=1S/C11H12.C5H13N/c1-3-7-11-9-6-5-8-10(11)4-2;1-3-5-6-4-2/h3-9H,2H2,1H3;6H,3-5H2,1-2H3/b7-3-;.
What are the key properties of 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine?
1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine has a molecular weight of 231.38 g/mol, XLogP of 4.37, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-[(Z)-prop-1-enyl]benzene;N-ethylpropan-1-amine is sourced from PubChem (CID 156725547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).