C18H26 — CID 143566637
ethane;1-prop-1-enyl-10-propylcyclodeca-1,3,5,7,9-pentaene (PubChem CID 143566637) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is ethane;1-prop-1-enyl-10-propylcyclodeca-1,3,5,7,9-pentaene.
| Compound Name | ethane;1-prop-1-enyl-10-propylcyclodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 143566637 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethane;1-prop-1-enyl-10-propylcyclodeca-1,3,5,7,9-pentaene |
| SMILES | CC.CC=Cc1ccccccccc1CCC |
| InChI | InChI=1S/C16H20.C2H6/c1-3-11-15-13-9-7-5-6-8-10-14-16(15)12-4-2;1-2/h3,5-11,13-14H,4,12H2,1-2H3;1-2H3/b6-5-,7-5-,8-6-,9-7+,10-8+,11-3?,13-9+,14-10+,15-13-,16-14-,16-15-; |
| InChIKey | OWFWSYVYJXVULD-XDANHECZSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |