About 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne
1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne (PubChem CID 142194748) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne.
Molecular Properties
| Compound Name | 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne |
| PubChem CID | 142194748 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne |
| SMILES | C#CC.C/C=C/c1ccccc1CC |
| InChI | InChI=1S/C11H14.C3H4/c1-3-7-11-9-6-5-8-10(11)4-2;1-3-2/h3,5-9H,4H2,1-2H3;1H,2H3/b7-3+; |
| InChIKey | HIYAXRGLFRTQIJ-CDQVLDCRSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne?
The IUPAC name of 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne (CID 142194748) is 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne.
What is the SMILES notation for 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne?
The canonical SMILES for 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne is C#CC.C/C=C/c1ccccc1CC.
What is the InChIKey of 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne?
The InChIKey is HIYAXRGLFRTQIJ-CDQVLDCRSA-N. The full InChI is InChI=1S/C11H14.C3H4/c1-3-7-11-9-6-5-8-10(11)4-2;1-3-2/h3,5-9H,4H2,1-2H3;1H,2H3/b7-3+;.
What are the key properties of 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne?
1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne has a molecular weight of 186.30 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-[(E)-prop-1-enyl]benzene;prop-1-yne is sourced from PubChem (CID 142194748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).