C30H34 — CID 102216000
1,4-bis[(E)-2-(2-ethylphenyl)ethenyl]-2,3,5,6-tetramethylbenzene (PubChem CID 102216000) has the molecular formula C30H34 and a molecular weight of 394.60 g/mol. Its IUPAC name is 1,4-bis[(E)-2-(2-ethylphenyl)ethenyl]-2,3,5,6-tetramethylbenzene.
| Compound Name | 1,4-bis[(E)-2-(2-ethylphenyl)ethenyl]-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 102216000 |
| Molecular Formula | C30H34 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1,4-bis[(E)-2-(2-ethylphenyl)ethenyl]-2,3,5,6-tetramethylbenzene |
| SMILES | CCc1ccccc1/C=C/c1c(C)c(C)c(/C=C/c2ccccc2CC)c(C)c1C |
| InChI | InChI=1S/C30H34/c1-7-25-13-9-11-15-27(25)17-19-29-21(3)23(5)30(24(6)22(29)4)20-18-28-16-12-10-14-26(28)8-2/h9-20H,7-8H2,1-6H3/b19-17+,20-18+ |
| InChIKey | SECQMECKSYOIHF-XPWSMXQVSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|