About 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane
1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane (PubChem CID 142595555) has the molecular formula C15H21Br
and a molecular weight of 281.24 g/mol. Its IUPAC name is 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane.
Molecular Properties
| Compound Name | 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane |
| PubChem CID | 142595555 |
| Molecular Formula | C15H21Br |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane |
| SMILES | C=Cc1c(Br)cccc1/C=C\C.CCCC |
| InChI | InChI=1S/C11H11Br.C4H10/c1-3-6-9-7-5-8-11(12)10(9)4-2;1-3-4-2/h3-8H,2H2,1H3;3-4H2,1-2H3/b6-3-; |
| InChIKey | JFJAMORIQPOTML-AQPBACSKSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane?
The IUPAC name of 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane (CID 142595555) is 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane.
What is the SMILES notation for 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane?
The canonical SMILES for 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane is C=Cc1c(Br)cccc1/C=C\C.CCCC.
What is the InChIKey of 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane?
The InChIKey is JFJAMORIQPOTML-AQPBACSKSA-N. The full InChI is InChI=1S/C11H11Br.C4H10/c1-3-6-9-7-5-8-11(12)10(9)4-2;1-3-4-2/h3-8H,2H2,1H3;3-4H2,1-2H3/b6-3-;.
What are the key properties of 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane?
1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane has a molecular weight of 281.24 g/mol, XLogP of 5.93, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-ethenyl-3-[(Z)-prop-1-enyl]benzene;butane is sourced from PubChem (CID 142595555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).