C39H11BF23NOS — CID 139744044
3-benzyl-2-(trifluoromethoxy)-1,3-benzothiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139744044) has the molecular formula C39H11BF23NOS and a molecular weight of 989.36 g/mol. Its IUPAC name is 3-benzyl-2-(trifluoromethoxy)-1,3-benzothiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 3-benzyl-2-(trifluoromethoxy)-1,3-benzothiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139744044 |
| Molecular Formula | C39H11BF23NOS |
| Molecular Weight | 989.36 g/mol |
| Exact Mass | 989.03 |
| IUPAC Name | 3-benzyl-2-(trifluoromethoxy)-1,3-benzothiazol-3-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | FC(F)(F)Oc1sc2ccccc2[n+]1Cc1ccccc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C15H11F3NOS/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;16-15(17,18)20-14-19(10-11-6-2-1-3-7-11)12-8-4-5-9-13(12)21-14/h;1-9H,10H2/q-1;+1 |
| InChIKey | NPMLLSIVSQGNSQ-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.36 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|