C9H11INS+ — CID 126959882
2,3-dimethyl-1,3-benzothiazol-3-ium;hydroiodide (PubChem CID 126959882) has the molecular formula C9H11INS+ and a molecular weight of 292.17 g/mol. Its IUPAC name is 2,3-dimethyl-1,3-benzothiazol-3-ium;hydroiodide.
| Compound Name | 2,3-dimethyl-1,3-benzothiazol-3-ium;hydroiodide |
|---|---|
| PubChem CID | 126959882 |
| Molecular Formula | C9H11INS+ |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 2,3-dimethyl-1,3-benzothiazol-3-ium;hydroiodide |
| SMILES | Cc1sc2ccccc2[n+]1C.I |
| InChI | InChI=1S/C9H10NS.HI/c1-7-10(2)8-5-3-4-6-9(8)11-7;/h3-6H,1-2H3;1H/q+1; |
| InChIKey | VZRIFNLQJXPRJI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|