C8H7NOS — CID 13285743
2-methyl-3-oxido-1,3-benzothiazol-3-ium (PubChem CID 13285743) has the molecular formula C8H7NOS and a molecular weight of 165.22 g/mol. Its IUPAC name is 2-methyl-3-oxido-1,3-benzothiazol-3-ium.
| Compound Name | 2-methyl-3-oxido-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 13285743 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 2-methyl-3-oxido-1,3-benzothiazol-3-ium |
| SMILES | Cc1sc2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C8H7NOS/c1-6-9(10)7-4-2-3-5-8(7)11-6/h2-5H,1H3 |
| InChIKey | INPKNILVJBVTCN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|