C11H12N2O2S — CID 67786195
N-[2-(3-oxido-1,3-benzothiazol-3-ium-2-yl)ethyl]acetamide (PubChem CID 67786195) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is N-[2-(3-oxido-1,3-benzothiazol-3-ium-2-yl)ethyl]acetamide.
| Compound Name | N-[2-(3-oxido-1,3-benzothiazol-3-ium-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 67786195 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | N-[2-(3-oxido-1,3-benzothiazol-3-ium-2-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCc1sc2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C11H12N2O2S/c1-8(14)12-7-6-11-13(15)9-4-2-3-5-10(9)16-11/h2-5H,6-7H2,1H3,(H,12,14) |
| InChIKey | HNVMLBHYVQSZHZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|