C12H13NOS — CID 134965544
N-[(3-methyl-1-benzothiophen-2-yl)methyl]acetamide (PubChem CID 134965544) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is N-[(3-methyl-1-benzothiophen-2-yl)methyl]acetamide.
| Compound Name | N-[(3-methyl-1-benzothiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 134965544 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N-[(3-methyl-1-benzothiophen-2-yl)methyl]acetamide |
| SMILES | CC(=O)NCc1sc2ccccc2c1C |
| InChI | InChI=1S/C12H13NOS/c1-8-10-5-3-4-6-11(10)15-12(8)7-13-9(2)14/h3-6H,7H2,1-2H3,(H,13,14) |
| InChIKey | SGVHKTZAXZXOJB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |