C15H16S — CID 174313018
3-methyl-2-(4-methylpenta-1,4-dien-2-yl)-1-benzothiophene (PubChem CID 174313018) has the molecular formula C15H16S and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-methyl-2-(4-methylpenta-1,4-dien-2-yl)-1-benzothiophene.
| Compound Name | 3-methyl-2-(4-methylpenta-1,4-dien-2-yl)-1-benzothiophene |
|---|---|
| PubChem CID | 174313018 |
| Molecular Formula | C15H16S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-methyl-2-(4-methylpenta-1,4-dien-2-yl)-1-benzothiophene |
| SMILES | C=C(C)CC(=C)c1sc2ccccc2c1C |
| InChI | InChI=1S/C15H16S/c1-10(2)9-11(3)15-12(4)13-7-5-6-8-14(13)16-15/h5-8H,1,3,9H2,2,4H3 |
| InChIKey | XDIKCECOUHBSKR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|