C12H9NO2S — CID 8666019
cyanomethyl 3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 8666019) has the molecular formula C12H9NO2S and a molecular weight of 231.28 g/mol. Its IUPAC name is cyanomethyl 3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | cyanomethyl 3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8666019 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | cyanomethyl 3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC#N)sc2ccccc12 |
| InChI | InChI=1S/C12H9NO2S/c1-8-9-4-2-3-5-10(9)16-11(8)12(14)15-7-6-13/h2-5H,7H2,1H3 |
| InChIKey | GVBCJPRCRQFYPV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |