C18H16O3S — CID 132545134
(3Z)-3-[1-(3-methyl-1-benzothiophen-2-yl)ethylidene]-4-propan-2-ylideneoxolane-2,5-dione (PubChem CID 132545134) has the molecular formula C18H16O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is (3Z)-3-[1-(3-methyl-1-benzothiophen-2-yl)ethylidene]-4-propan-2-ylideneoxolane-2,5-dione.
| Compound Name | (3Z)-3-[1-(3-methyl-1-benzothiophen-2-yl)ethylidene]-4-propan-2-ylideneoxolane-2,5-dione |
|---|---|
| PubChem CID | 132545134 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (3Z)-3-[1-(3-methyl-1-benzothiophen-2-yl)ethylidene]-4-propan-2-ylideneoxolane-2,5-dione |
| SMILES | CC(C)=C1C(=O)OC(=O)/C1=C(/C)c1sc2ccccc2c1C |
| InChI | InChI=1S/C18H16O3S/c1-9(2)14-15(18(20)21-17(14)19)11(4)16-10(3)12-7-5-6-8-13(12)22-16/h5-8H,1-4H3/b15-11- |
| InChIKey | QEYNCCNAIZKOGE-PTNGSMBKSA-N |
| XLogP | 4.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|