C12H17BrNS+ — CID 126959540
3-tert-butyl-2-methyl-1,3-benzothiazol-3-ium;hydrobromide (PubChem CID 126959540) has the molecular formula C12H17BrNS+ and a molecular weight of 287.25 g/mol. Its IUPAC name is 3-tert-butyl-2-methyl-1,3-benzothiazol-3-ium;hydrobromide.
| Compound Name | 3-tert-butyl-2-methyl-1,3-benzothiazol-3-ium;hydrobromide |
|---|---|
| PubChem CID | 126959540 |
| Molecular Formula | C12H17BrNS+ |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-tert-butyl-2-methyl-1,3-benzothiazol-3-ium;hydrobromide |
| SMILES | Br.Cc1sc2ccccc2[n+]1C(C)(C)C |
| InChI | InChI=1S/C12H16NS.BrH/c1-9-13(12(2,3)4)10-7-5-6-8-11(10)14-9;/h5-8H,1-4H3;1H/q+1; |
| InChIKey | NKSLZDMJHLFZTB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|