C14H20NOS2+ — CID 143781424
ethane;S-[2-(2-methyl-1,3-benzothiazol-3-ium-3-yl)ethyl] ethanethioate (PubChem CID 143781424) has the molecular formula C14H20NOS2+ and a molecular weight of 282.45 g/mol. Its IUPAC name is ethane;S-[2-(2-methyl-1,3-benzothiazol-3-ium-3-yl)ethyl] ethanethioate.
| Compound Name | ethane;S-[2-(2-methyl-1,3-benzothiazol-3-ium-3-yl)ethyl] ethanethioate |
|---|---|
| PubChem CID | 143781424 |
| Molecular Formula | C14H20NOS2+ |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | ethane;S-[2-(2-methyl-1,3-benzothiazol-3-ium-3-yl)ethyl] ethanethioate |
| SMILES | CC.CC(=O)SCC[n+]1c(C)sc2ccccc21 |
| InChI | InChI=1S/C12H14NOS2.C2H6/c1-9-13(7-8-15-10(2)14)11-5-3-4-6-12(11)16-9;1-2/h3-6H,7-8H2,1-2H3;1-2H3/q+1; |
| InChIKey | SQKKGEFXBNSDCM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|