C13H13INS+ — CID 126959698
1,2-dimethylbenzo[e][1,3]benzothiazol-1-ium;hydroiodide (PubChem CID 126959698) has the molecular formula C13H13INS+ and a molecular weight of 342.23 g/mol. Its IUPAC name is 1,2-dimethylbenzo[e][1,3]benzothiazol-1-ium;hydroiodide.
| Compound Name | 1,2-dimethylbenzo[e][1,3]benzothiazol-1-ium;hydroiodide |
|---|---|
| PubChem CID | 126959698 |
| Molecular Formula | C13H13INS+ |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 1,2-dimethylbenzo[e][1,3]benzothiazol-1-ium;hydroiodide |
| SMILES | Cc1sc2ccc3ccccc3c2[n+]1C.I |
| InChI | InChI=1S/C13H12NS.HI/c1-9-14(2)13-11-6-4-3-5-10(11)7-8-12(13)15-9;/h3-8H,1-2H3;1H/q+1; |
| InChIKey | XWKUOAHFKGMBSY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|