C24H21N2S+ — CID 6912105
1-methyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium (PubChem CID 6912105) has the molecular formula C24H21N2S+ and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-methyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium.
| Compound Name | 1-methyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium |
|---|---|
| PubChem CID | 6912105 |
| Molecular Formula | C24H21N2S+ |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-methyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium |
| SMILES | C/C(=C\c1sc2ccc3ccccc3c2[n+]1C)c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H20N2S/c1-15(23-16(2)25-20-11-7-6-10-19(20)23)14-22-26(3)24-18-9-5-4-8-17(18)12-13-21(24)27-22/h4-14H,1-3H3/p+1 |
| InChIKey | ZGQNWMATNYKDCO-UHFFFAOYSA-O |
| XLogP | 6.23 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|