C18H13ClNS2+ — CID 21119115
2-[(Z)-2-chloro-2-thiophen-2-ylethenyl]-1-methylbenzo[e][1,3]benzothiazol-1-ium (PubChem CID 21119115) has the molecular formula C18H13ClNS2+ and a molecular weight of 342.90 g/mol. Its IUPAC name is 2-[(Z)-2-chloro-2-thiophen-2-ylethenyl]-1-methylbenzo[e][1,3]benzothiazol-1-ium.
| Compound Name | 2-[(Z)-2-chloro-2-thiophen-2-ylethenyl]-1-methylbenzo[e][1,3]benzothiazol-1-ium |
|---|---|
| PubChem CID | 21119115 |
| Molecular Formula | C18H13ClNS2+ |
| Molecular Weight | 342.90 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-[(Z)-2-chloro-2-thiophen-2-ylethenyl]-1-methylbenzo[e][1,3]benzothiazol-1-ium |
| SMILES | C[n+]1c(/C=C(\Cl)c2cccs2)sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C18H13ClNS2/c1-20-17(11-14(19)15-7-4-10-21-15)22-16-9-8-12-5-2-3-6-13(12)18(16)20/h2-11H,1H3/q+1/b14-11- |
| InChIKey | IWEWUUZTBJWSLF-KAMYIIQDSA-N |
| XLogP | 5.68 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.90 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|