C26H25N2S2+ — CID 54544764
1-methyl-2-[2-methyl-3-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium (PubChem CID 54544764) has the molecular formula C26H25N2S2+ and a molecular weight of 429.63 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-3-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-3-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium |
|---|---|
| PubChem CID | 54544764 |
| Molecular Formula | C26H25N2S2+ |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 1-methyl-2-[2-methyl-3-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazol-1-ium |
| SMILES | CC(=Cc1sc2ccc3ccccc3c2[n+]1C)C=C1Sc2cc(C)c(C)cc2N1C |
| InChI | InChI=1S/C26H25N2S2/c1-16(12-24-27(4)21-14-17(2)18(3)15-23(21)30-24)13-25-28(5)26-20-9-7-6-8-19(20)10-11-22(26)29-25/h6-15H,1-5H3/q+1 |
| InChIKey | ZFTIPYBQJUMBDF-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|