C30H33N2O4S3+ — CID 99119905
3-[(2Z)-2-[(2E)-2-[(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)methylidene]butylidene]-5,6-dimethyl-1,3-benzothiazol-3-yl]propyl hydrogen sulfate (PubChem CID 99119905) has the molecular formula C30H33N2O4S3+ and a molecular weight of 581.81 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2E)-2-[(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)methylidene]butylidene]-5,6-dimethyl-1,3-benzothiazol-3-yl]propyl hydrogen sulfate.
| Compound Name | 3-[(2Z)-2-[(2E)-2-[(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)methylidene]butylidene]-5,6-dimethyl-1,3-benzothiazol-3-yl]propyl hydrogen sulfate |
|---|---|
| PubChem CID | 99119905 |
| Molecular Formula | C30H33N2O4S3+ |
| Molecular Weight | 581.81 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | 3-[(2Z)-2-[(2E)-2-[(1-ethylbenzo[e][1,3]benzothiazol-1-ium-2-yl)methylidene]butylidene]-5,6-dimethyl-1,3-benzothiazol-3-yl]propyl hydrogen sulfate |
| SMILES | CCC(/C=C1\Sc2cc(C)c(C)cc2N1CCCOS(=O)(=O)O)=C\c1sc2ccc3ccccc3c2[n+]1CC |
| InChI | InChI=1S/C30H32N2O4S3/c1-5-22(18-28-31(6-2)30-24-11-8-7-10-23(24)12-13-26(30)37-28)19-29-32(14-9-15-36-39(33,34)35)25-16-20(3)21(4)17-27(25)38-29/h7-8,10-13,16-19H,5-6,9,14-15H2,1-4H3/p+1 |
| InChIKey | YPAKGQWVNWDBAZ-UHFFFAOYSA-O |
| XLogP | 7.44 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.81 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|